C19H21ClO4 — CID 166447291
[(3aR,4R,5R,6aS)-4-(4-chloro-2-methylidenebutyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 166447291) has the molecular formula C19H21ClO4 and a molecular weight of 348.83 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-(4-chloro-2-methylidenebutyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-(4-chloro-2-methylidenebutyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 166447291 |
| Molecular Formula | C19H21ClO4 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-(4-chloro-2-methylidenebutyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | C=C(CCCl)C[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21ClO4/c1-12(7-8-20)9-14-15-10-18(21)23-16(15)11-17(14)24-19(22)13-5-3-2-4-6-13/h2-6,14-17H,1,7-11H2/t14-,15-,16+,17-/m1/s1 |
| InChIKey | NGVWIUOWHWTROX-WCXIOVBPSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|