C22H26F2O5 — CID 20672793
[4-(4,4-difluoro-3-oxooctyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 20672793) has the molecular formula C22H26F2O5 and a molecular weight of 408.44 g/mol. Its IUPAC name is [4-(4,4-difluoro-3-oxooctyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [4-(4,4-difluoro-3-oxooctyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 20672793 |
| Molecular Formula | C22H26F2O5 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [4-(4,4-difluoro-3-oxooctyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | CCCCC(F)(F)C(=O)CCC1C(OC(=O)c2ccccc2)CC2OC(=O)CC21 |
| InChI | InChI=1S/C22H26F2O5/c1-2-3-11-22(23,24)19(25)10-9-15-16-12-20(26)28-18(16)13-17(15)29-21(27)14-7-5-4-6-8-14/h4-8,15-18H,2-3,9-13H2,1H3 |
| InChIKey | KNYYHPWMEOFDEC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |