C15H22O7 — CID 166447871
5-[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxolan-2-one (PubChem CID 166447871) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is 5-[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxolan-2-one.
| Compound Name | 5-[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxolan-2-one |
|---|---|
| PubChem CID | 166447871 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5-[(6R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]oxolan-2-one |
| SMILES | CC1(C)OC2C3OC(C)(C)O[C@H]3C(C3CCC(=O)O3)O[C@@H]2O1 |
| InChI | InChI=1S/C15H22O7/c1-14(2)19-10-9(7-5-6-8(16)17-7)18-13-12(11(10)20-14)21-15(3,4)22-13/h7,9-13H,5-6H2,1-4H3/t7?,9?,10-,11?,12?,13+/m0/s1 |
| InChIKey | VIOAHKBYXFQDRF-QPOYWVOGSA-N |
| XLogP | 1.09 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |