C22H40O5Si — CID 166448820
2-[(3R,3aR,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethyl)-3,6,7-trimethyl-5-oxo-2,3,4,7a-tetrahydro-1H-inden-3a-yl]acetic acid (PubChem CID 166448820) has the molecular formula C22H40O5Si and a molecular weight of 412.64 g/mol. Its IUPAC name is 2-[(3R,3aR,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethyl)-3,6,7-trimethyl-5-oxo-2,3,4,7a-tetrahydro-1H-inden-3a-yl]acetic acid.
| Compound Name | 2-[(3R,3aR,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethyl)-3,6,7-trimethyl-5-oxo-2,3,4,7a-tetrahydro-1H-inden-3a-yl]acetic acid |
|---|---|
| PubChem CID | 166448820 |
| Molecular Formula | C22H40O5Si |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 2-[(3R,3aR,7R)-6-[tert-butyl(dimethyl)silyl]oxy-7-(methoxymethyl)-3,6,7-trimethyl-5-oxo-2,3,4,7a-tetrahydro-1H-inden-3a-yl]acetic acid |
| SMILES | COC[C@@]1(C)C2CC[C@@H](C)[C@]2(CC(=O)O)CC(=O)C1(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O5Si/c1-15-10-11-16-20(5,14-26-7)21(6,27-28(8,9)19(2,3)4)17(23)12-22(15,16)13-18(24)25/h15-16H,10-14H2,1-9H3,(H,24,25)/t15-,16?,20+,21?,22-/m1/s1 |
| InChIKey | FUSXJTDVHBMBHF-GUBDIQGUSA-N |
| XLogP | 4.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|