C23H40O4Si — CID 46894182
(3aS,5aR,6R,8aR,8bR)-6-[(2R)-5-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]-5a-methyl-1,3a,4,5,6,7,8a,8b-octahydrocyclopenta[e][1]benzofuran-2,8-dione (PubChem CID 46894182) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (3aS,5aR,6R,8aR,8bR)-6-[(2R)-5-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]-5a-methyl-1,3a,4,5,6,7,8a,8b-octahydrocyclopenta[e][1]benzofuran-2,8-dione.
| Compound Name | (3aS,5aR,6R,8aR,8bR)-6-[(2R)-5-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]-5a-methyl-1,3a,4,5,6,7,8a,8b-octahydrocyclopenta[e][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 46894182 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (3aS,5aR,6R,8aR,8bR)-6-[(2R)-5-[tert-butyl(dimethyl)silyl]oxypentan-2-yl]-5a-methyl-1,3a,4,5,6,7,8a,8b-octahydrocyclopenta[e][1]benzofuran-2,8-dione |
| SMILES | C[C@H](CCCO[Si](C)(C)C(C)(C)C)[C@H]1CC(=O)[C@@H]2[C@H]3CC(=O)O[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H40O4Si/c1-15(9-8-12-26-28(6,7)22(2,3)4)17-14-18(24)21-16-13-20(25)27-19(16)10-11-23(17,21)5/h15-17,19,21H,8-14H2,1-7H3/t15-,16+,17-,19+,21+,23-/m1/s1 |
| InChIKey | QPWCVWFBGGOLFJ-AQTGJZCISA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|