C26H43NO4Si — CID 166449041
(4S)-4-benzyl-3-[(5R)-5-[tert-butyl(dimethyl)silyl]oxydecanoyl]-1,3-oxazolidin-2-one (PubChem CID 166449041) has the molecular formula C26H43NO4Si and a molecular weight of 461.72 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(5R)-5-[tert-butyl(dimethyl)silyl]oxydecanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(5R)-5-[tert-butyl(dimethyl)silyl]oxydecanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 166449041 |
| Molecular Formula | C26H43NO4Si |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | (4S)-4-benzyl-3-[(5R)-5-[tert-butyl(dimethyl)silyl]oxydecanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@H](CCCC(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H43NO4Si/c1-7-8-10-16-23(31-32(5,6)26(2,3)4)17-13-18-24(28)27-22(20-30-25(27)29)19-21-14-11-9-12-15-21/h9,11-12,14-15,22-23H,7-8,10,13,16-20H2,1-6H3/t22-,23+/m0/s1 |
| InChIKey | GBZOLSHYFUXHGM-XZOQPEGZSA-N |
| XLogP | 6.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|