C14H16N2O3 — CID 166449193
(7S)-4,4-dimethyl-9-pyridin-2-yl-3,5,8-trioxa-9-azatricyclo[5.2.2.02,6]undec-10-ene (PubChem CID 166449193) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (7S)-4,4-dimethyl-9-pyridin-2-yl-3,5,8-trioxa-9-azatricyclo[5.2.2.02,6]undec-10-ene.
| Compound Name | (7S)-4,4-dimethyl-9-pyridin-2-yl-3,5,8-trioxa-9-azatricyclo[5.2.2.02,6]undec-10-ene |
|---|---|
| PubChem CID | 166449193 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (7S)-4,4-dimethyl-9-pyridin-2-yl-3,5,8-trioxa-9-azatricyclo[5.2.2.02,6]undec-10-ene |
| SMILES | CC1(C)OC2C(O1)[C@@H]1C=CC2N(c2ccccn2)O1 |
| InChI | InChI=1S/C14H16N2O3/c1-14(2)17-12-9-6-7-10(13(12)18-14)19-16(9)11-5-3-4-8-15-11/h3-10,12-13H,1-2H3/t9?,10-,12?,13?/m0/s1 |
| InChIKey | XGGCEMQNWNIADH-GFWJOYCYSA-N |
| XLogP | 1.66 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|