C24H32O6 — CID 166449609
(8R,9S,13S,14S)-13-methyl-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 166449609) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-methyl-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-13-methyl-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 166449609 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (8R,9S,13S,14S)-13-methyl-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@@H]3c4ccc([C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H32O6/c1-24-9-8-15-14-4-3-13(23-22(29)21(28)20(27)18(11-25)30-23)10-12(14)2-5-16(15)17(24)6-7-19(24)26/h3-4,10,15-18,20-23,25,27-29H,2,5-9,11H2,1H3/t15-,16-,17+,18-,20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | KYHHYVCOCADHRF-ZRGIZAJZSA-N |
| XLogP | 1.63 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |