About bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene
bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene (PubChem CID 166449619) has the molecular formula C19H16BrF3N2NiO2-
and a molecular weight of 499.94 g/mol. Its IUPAC name is bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene.
Molecular Properties
| Compound Name | bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene |
| PubChem CID | 166449619 |
| Molecular Formula | C19H16BrF3N2NiO2- |
| Molecular Weight | 499.94 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene |
| SMILES | COc1ccnc(-c2cc(OC)ccn2)c1.FC(F)(F)c1cc[c-]cc1.[Ni]Br |
| InChI | InChI=1S/C12H12N2O2.C7H4F3.BrH.Ni/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12;8-7(9,10)6-4-2-1-3-5-6;;/h3-8H,1-2H3;2-5H;1H;/q;-1;;+1/p-1 |
| InChIKey | GQBZEAPDKCWEEI-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.94 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene?
The IUPAC name of bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene (CID 166449619) is bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene.
What is the SMILES notation for bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene?
The canonical SMILES for bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene is COc1ccnc(-c2cc(OC)ccn2)c1.FC(F)(F)c1cc[c-]cc1.[Ni]Br.
What is the InChIKey of bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene?
The InChIKey is GQBZEAPDKCWEEI-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H12N2O2.C7H4F3.BrH.Ni/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12;8-7(9,10)6-4-2-1-3-5-6;;/h3-8H,1-2H3;2-5H;1H;/q;-1;;+1/p-1.
What are the key properties of bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene?
bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene has a molecular weight of 499.94 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bromonickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine;trifluoromethylbenzene is sourced from PubChem (CID 166449619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).