C14H17NP2 — CID 166453804
2,2-bis(phenylphosphanyl)ethanamine (PubChem CID 166453804) has the molecular formula C14H17NP2 and a molecular weight of 261.25 g/mol. Its IUPAC name is 2,2-bis(phenylphosphanyl)ethanamine.
| Compound Name | 2,2-bis(phenylphosphanyl)ethanamine |
|---|---|
| PubChem CID | 166453804 |
| Molecular Formula | C14H17NP2 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2,2-bis(phenylphosphanyl)ethanamine |
| SMILES | NCC(Pc1ccccc1)Pc1ccccc1 |
| InChI | InChI=1S/C14H17NP2/c15-11-14(16-12-7-3-1-4-8-12)17-13-9-5-2-6-10-13/h1-10,14,16-17H,11,15H2 |
| InChIKey | NIOCFFSCGMSVQR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|