C21H22ClP — CID 173459129
1,3-diphenylpropan-2-yl(phenyl)phosphane;hydrochloride (PubChem CID 173459129) has the molecular formula C21H22ClP and a molecular weight of 340.83 g/mol. Its IUPAC name is 1,3-diphenylpropan-2-yl(phenyl)phosphane;hydrochloride.
| Compound Name | 1,3-diphenylpropan-2-yl(phenyl)phosphane;hydrochloride |
|---|---|
| PubChem CID | 173459129 |
| Molecular Formula | C21H22ClP |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1,3-diphenylpropan-2-yl(phenyl)phosphane;hydrochloride |
| SMILES | Cl.c1ccc(CC(Cc2ccccc2)Pc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21P.ClH/c1-4-10-18(11-5-1)16-21(17-19-12-6-2-7-13-19)22-20-14-8-3-9-15-20;/h1-15,21-22H,16-17H2;1H |
| InChIKey | DVBKNWYFCAYWOV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|