C17H19N3OS — CID 16645489
N-[(E)-cyclohex-3-en-1-ylmethylideneamino]-4-(4-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 16645489) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is N-[(E)-cyclohex-3-en-1-ylmethylideneamino]-4-(4-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-cyclohex-3-en-1-ylmethylideneamino]-4-(4-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 16645489 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[(E)-cyclohex-3-en-1-ylmethylideneamino]-4-(4-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(N/N=C/C3CC=CCC3)n2)cc1 |
| InChI | InChI=1S/C17H19N3OS/c1-21-15-9-7-14(8-10-15)16-12-22-17(19-16)20-18-11-13-5-3-2-4-6-13/h2-3,7-13H,4-6H2,1H3,(H,19,20)/b18-11+ |
| InChIKey | XFPOHVQKFSXJCQ-WOJGMQOQSA-N |
| XLogP | 4.57 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|