C18H19F3N2O5 — CID 166457252
(5S,7R,8R,9S,10R)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]-1,6-dioxaspiro[4.5]decane-8,10-diol (PubChem CID 166457252) has the molecular formula C18H19F3N2O5 and a molecular weight of 400.35 g/mol. Its IUPAC name is (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]-1,6-dioxaspiro[4.5]decane-8,10-diol.
| Compound Name | (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]-1,6-dioxaspiro[4.5]decane-8,10-diol |
|---|---|
| PubChem CID | 166457252 |
| Molecular Formula | C18H19F3N2O5 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (5S,7R,8R,9S,10R)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]-1,6-dioxaspiro[4.5]decane-8,10-diol |
| SMILES | OC[C@H]1O[C@@]2(CCCO2)[C@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)cn2)[C@H]1O |
| InChI | InChI=1S/C18H19F3N2O5/c19-11-4-9(5-12(20)14(11)21)10-6-22-23(7-10)15-16(25)13(8-24)28-18(17(15)26)2-1-3-27-18/h4-7,13,15-17,24-26H,1-3,8H2/t13-,15+,16+,17-,18+/m1/s1 |
| InChIKey | QTPGGZMGMAQRSF-XNJHUCFUSA-N |
| XLogP | 1.13 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|