About tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate
tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate (PubChem CID 166457697) has the molecular formula C20H27NO3
and a molecular weight of 329.44 g/mol. Its IUPAC name is tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate |
| PubChem CID | 166457697 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate |
| SMILES | C=CC1=Cc2ccc(N(CC)C(=O)OC(C)(C)C)cc2OC1(C)C |
| InChI | InChI=1S/C20H27NO3/c1-8-15-12-14-10-11-16(13-17(14)23-20(15,6)7)21(9-2)18(22)24-19(3,4)5/h8,10-13H,1,9H2,2-7H3 |
| InChIKey | YOVYAMJKUGFSBZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate?
The IUPAC name of tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate (CID 166457697) is tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate.
What is the SMILES notation for tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate?
The canonical SMILES for tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate is C=CC1=Cc2ccc(N(CC)C(=O)OC(C)(C)C)cc2OC1(C)C.
What is the InChIKey of tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate?
The InChIKey is YOVYAMJKUGFSBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO3/c1-8-15-12-14-10-11-16(13-17(14)23-20(15,6)7)21(9-2)18(22)24-19(3,4)5/h8,10-13H,1,9H2,2-7H3.
What are the key properties of tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate?
tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate has a molecular weight of 329.44 g/mol, XLogP of 5.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3-ethenyl-2,2-dimethylchromen-7-yl)-N-ethylcarbamate is sourced from PubChem (CID 166457697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).