C15H20BrNO2 — CID 176883752
tert-butyl N-(3-bromo-4-methylphenyl)-N-prop-2-enylcarbamate (PubChem CID 176883752) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is tert-butyl N-(3-bromo-4-methylphenyl)-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-(3-bromo-4-methylphenyl)-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 176883752 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | tert-butyl N-(3-bromo-4-methylphenyl)-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C15H20BrNO2/c1-6-9-17(14(18)19-15(3,4)5)12-8-7-11(2)13(16)10-12/h6-8,10H,1,9H2,2-5H3 |
| InChIKey | POSRVLVDADQSBJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|