C16H19N5O2 — CID 166458219
4-[6-(2-hydroxyphenyl)-3-(methylamino)pyridazin-4-yl]piperazine-1-carbaldehyde (PubChem CID 166458219) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-[6-(2-hydroxyphenyl)-3-(methylamino)pyridazin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[6-(2-hydroxyphenyl)-3-(methylamino)pyridazin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 166458219 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-[6-(2-hydroxyphenyl)-3-(methylamino)pyridazin-4-yl]piperazine-1-carbaldehyde |
| SMILES | CNc1nnc(-c2ccccc2O)cc1N1CCN(C=O)CC1 |
| InChI | InChI=1S/C16H19N5O2/c1-17-16-14(21-8-6-20(11-22)7-9-21)10-13(18-19-16)12-4-2-3-5-15(12)23/h2-5,10-11,23H,6-9H2,1H3,(H,17,19) |
| InChIKey | ZPTJQJYPJFMRDG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|