C12H15FmN4O5- — CID 166460116
fermium;2-[2-(oxomethylamino)ethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetic acid (PubChem CID 166460116) has the molecular formula C12H15FmN4O5- and a molecular weight of 552.28 g/mol. Its IUPAC name is fermium;2-[2-(oxomethylamino)ethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetic acid.
| Compound Name | fermium;2-[2-(oxomethylamino)ethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 166460116 |
| Molecular Formula | C12H15FmN4O5- |
| Molecular Weight | 552.28 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | fermium;2-[2-(oxomethylamino)ethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetic acid |
| SMILES | O=[C-]NCCN(CC(=O)O)C(=O)CCn1cccnc1=O.[Fm] |
| InChI | InChI=1S/C12H15N4O5.Fm/c17-9-13-4-7-16(8-11(19)20)10(18)2-6-15-5-1-3-14-12(15)21;/h1,3,5H,2,4,6-8H2,(H,13,17)(H,19,20);/q-1; |
| InChIKey | IZIUBGAGAQXPIC-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.28 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|