C15H19FmN4O5- — CID 166460079
fermium;prop-2-enyl 2-[2-(oxomethylamino)ethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetate (PubChem CID 166460079) has the molecular formula C15H19FmN4O5- and a molecular weight of 592.34 g/mol. Its IUPAC name is fermium;prop-2-enyl 2-[2-(oxomethylamino)ethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetate.
| Compound Name | fermium;prop-2-enyl 2-[2-(oxomethylamino)ethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 166460079 |
| Molecular Formula | C15H19FmN4O5- |
| Molecular Weight | 592.34 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | fermium;prop-2-enyl 2-[2-(oxomethylamino)ethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetate |
| SMILES | C=CCOC(=O)CN(CCN[C-]=O)C(=O)CCn1cccnc1=O.[Fm] |
| InChI | InChI=1S/C15H19N4O5.Fm/c1-2-10-24-14(22)11-19(9-6-16-12-20)13(21)4-8-18-7-3-5-17-15(18)23;/h2-3,5,7H,1,4,6,8-11H2,(H,16,20);/q-1; |
| InChIKey | VFLZBHDHMLLKRS-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.34 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|