C15H20N4O5 — CID 166460080
prop-2-enyl 2-[2-formamidoethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetate (PubChem CID 166460080) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is prop-2-enyl 2-[2-formamidoethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetate.
| Compound Name | prop-2-enyl 2-[2-formamidoethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetate |
|---|---|
| PubChem CID | 166460080 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | prop-2-enyl 2-[2-formamidoethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetate |
| SMILES | C=CCOC(=O)CN(CCNC=O)C(=O)CCn1cccnc1=O |
| InChI | InChI=1S/C15H20N4O5/c1-2-10-24-14(22)11-19(9-6-16-12-20)13(21)4-8-18-7-3-5-17-15(18)23/h2-3,5,7,12H,1,4,6,8-11H2,(H,16,20) |
| InChIKey | FIWHECXFVJZJDL-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|