C12H16N4O5 — CID 166460117
2-[2-formamidoethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetic acid (PubChem CID 166460117) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2-[2-formamidoethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetic acid.
| Compound Name | 2-[2-formamidoethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 166460117 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[2-formamidoethyl-[3-(2-oxopyrimidin-1-yl)propanoyl]amino]acetic acid |
| SMILES | O=CNCCN(CC(=O)O)C(=O)CCn1cccnc1=O |
| InChI | InChI=1S/C12H16N4O5/c17-9-13-4-7-16(8-11(19)20)10(18)2-6-15-5-1-3-14-12(15)21/h1,3,5,9H,2,4,6-8H2,(H,13,17)(H,19,20) |
| InChIKey | OGNRXCYQEQTZMP-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|