C45H64O3 — CID 166463870
[4-[(1E,3E,5E,7E,9E,11E,13E,15E,19E)-3,7,12,16,18,20,24-heptamethylpentacosa-1,3,5,7,9,11,13,15,19,23-decaenyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] butanoate (PubChem CID 166463870) has the molecular formula C45H64O3 and a molecular weight of 653.00 g/mol. Its IUPAC name is [4-[(1E,3E,5E,7E,9E,11E,13E,15E,19E)-3,7,12,16,18,20,24-heptamethylpentacosa-1,3,5,7,9,11,13,15,19,23-decaenyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] butanoate.
| Compound Name | [4-[(1E,3E,5E,7E,9E,11E,13E,15E,19E)-3,7,12,16,18,20,24-heptamethylpentacosa-1,3,5,7,9,11,13,15,19,23-decaenyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] butanoate |
|---|---|
| PubChem CID | 166463870 |
| Molecular Formula | C45H64O3 |
| Molecular Weight | 653.00 g/mol |
| Exact Mass | 652.49 |
| IUPAC Name | [4-[(1E,3E,5E,7E,9E,11E,13E,15E,19E)-3,7,12,16,18,20,24-heptamethylpentacosa-1,3,5,7,9,11,13,15,19,23-decaenyl]-3,5,5-trimethyl-2-oxocyclohex-3-en-1-yl] butanoate |
| SMILES | CCCC(=O)OC1CC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)CC(C)/C=C(\C)CCC=C(C)C)=C(C)C1=O |
| InChI | InChI=1S/C45H64O3/c1-13-19-43(46)48-42-32-45(11,12)41(40(10)44(42)47)29-28-36(6)25-17-23-34(4)21-14-15-22-35(5)24-18-27-38(8)31-39(9)30-37(7)26-16-20-33(2)3/h14-15,17-18,20-25,27-30,39,42H,13,16,19,26,31-32H2,1-12H3/b15-14+,23-17+,24-18+,29-28+,34-21+,35-22+,36-25+,37-30+,38-27+ |
| InChIKey | KZTMWIUEJGLRHW-ZRYUJDLPSA-N |
| XLogP | 12.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.00 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|