C23H33N5O3S — CID 16646438
2-[4-(azepan-1-ylsulfonyl)phenyl]-5-[3-(diethylamino)propylamino]-1,3-oxazole-4-carbonitrile (PubChem CID 16646438) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is 2-[4-(azepan-1-ylsulfonyl)phenyl]-5-[3-(diethylamino)propylamino]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-[4-(azepan-1-ylsulfonyl)phenyl]-5-[3-(diethylamino)propylamino]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 16646438 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-[4-(azepan-1-ylsulfonyl)phenyl]-5-[3-(diethylamino)propylamino]-1,3-oxazole-4-carbonitrile |
| SMILES | CCN(CC)CCCNc1oc(-c2ccc(S(=O)(=O)N3CCCCCC3)cc2)nc1C#N |
| InChI | InChI=1S/C23H33N5O3S/c1-3-27(4-2)15-9-14-25-23-21(18-24)26-22(31-23)19-10-12-20(13-11-19)32(29,30)28-16-7-5-6-8-17-28/h10-13,25H,3-9,14-17H2,1-2H3 |
| InChIKey | CQWRNKPVMHWXKF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|