C20H22N6O4S — CID 16646329
5-(3-imidazol-1-ylpropylamino)-2-(4-morpholin-4-ylsulfonylphenyl)-1,3-oxazole-4-carbonitrile (PubChem CID 16646329) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is 5-(3-imidazol-1-ylpropylamino)-2-(4-morpholin-4-ylsulfonylphenyl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-(3-imidazol-1-ylpropylamino)-2-(4-morpholin-4-ylsulfonylphenyl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 16646329 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 5-(3-imidazol-1-ylpropylamino)-2-(4-morpholin-4-ylsulfonylphenyl)-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)oc1NCCCn1ccnc1 |
| InChI | InChI=1S/C20H22N6O4S/c21-14-18-20(23-6-1-8-25-9-7-22-15-25)30-19(24-18)16-2-4-17(5-3-16)31(27,28)26-10-12-29-13-11-26/h2-5,7,9,15,23H,1,6,8,10-13H2 |
| InChIKey | WHAISRQECXDZNC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 126.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|