C19H19N5O — CID 73253910
5-(3-imidazol-1-ylpropylamino)-2-(2-phenylcyclopropyl)-1,3-oxazole-4-carbonitrile (PubChem CID 73253910) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 5-(3-imidazol-1-ylpropylamino)-2-(2-phenylcyclopropyl)-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-(3-imidazol-1-ylpropylamino)-2-(2-phenylcyclopropyl)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 73253910 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-(3-imidazol-1-ylpropylamino)-2-(2-phenylcyclopropyl)-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1nc(C2CC2c2ccccc2)oc1NCCCn1ccnc1 |
| InChI | InChI=1S/C19H19N5O/c20-12-17-19(22-7-4-9-24-10-8-21-13-24)25-18(23-17)16-11-15(16)14-5-2-1-3-6-14/h1-3,5-6,8,10,13,15-16,22H,4,7,9,11H2 |
| InChIKey | BVJCPUOLMPKJCZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|