C19H21N5O2 — CID 139582870
2-[(3,5-dimethylphenoxy)methyl]-5-(3-imidazol-1-ylpropylamino)-1,3-oxazole-4-carbonitrile (PubChem CID 139582870) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenoxy)methyl]-5-(3-imidazol-1-ylpropylamino)-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-[(3,5-dimethylphenoxy)methyl]-5-(3-imidazol-1-ylpropylamino)-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 139582870 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[(3,5-dimethylphenoxy)methyl]-5-(3-imidazol-1-ylpropylamino)-1,3-oxazole-4-carbonitrile |
| SMILES | Cc1cc(C)cc(OCc2nc(C#N)c(NCCCn3ccnc3)o2)c1 |
| InChI | InChI=1S/C19H21N5O2/c1-14-8-15(2)10-16(9-14)25-12-18-23-17(11-20)19(26-18)22-4-3-6-24-7-5-21-13-24/h5,7-10,13,22H,3-4,6,12H2,1-2H3 |
| InChIKey | MYTOBESUPMWNQD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|