C16H23N5 — CID 76873394
3-imidazol-1-yl-N-[(3-phenylpyrazolidin-4-yl)methyl]propan-1-amine (PubChem CID 76873394) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[(3-phenylpyrazolidin-4-yl)methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[(3-phenylpyrazolidin-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 76873394 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 3-imidazol-1-yl-N-[(3-phenylpyrazolidin-4-yl)methyl]propan-1-amine |
| SMILES | c1ccc(C2NNCC2CNCCCn2ccnc2)cc1 |
| InChI | InChI=1S/C16H23N5/c1-2-5-14(6-3-1)16-15(12-19-20-16)11-17-7-4-9-21-10-8-18-13-21/h1-3,5-6,8,10,13,15-17,19-20H,4,7,9,11-12H2 |
| InChIKey | HORGQZLRCJYIJE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|