C14H14N2O2 — CID 166465371
3-(3,6-dihydro-2H-pyran-4-ylmethyl)quinazolin-4-one (PubChem CID 166465371) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyran-4-ylmethyl)quinazolin-4-one.
| Compound Name | 3-(3,6-dihydro-2H-pyran-4-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 166465371 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyran-4-ylmethyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1CC1=CCOCC1 |
| InChI | InChI=1S/C14H14N2O2/c17-14-12-3-1-2-4-13(12)15-10-16(14)9-11-5-7-18-8-6-11/h1-5,10H,6-9H2 |
| InChIKey | NJUPYGFHCBCHBT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|