C49H91NO4 — CID 166470332
[(5Z,8Z,29Z,32Z)-heptatriaconta-5,8,29,32-tetraen-19-yl] 4-(4,4-diethoxybutylamino)butanoate (PubChem CID 166470332) has the molecular formula C49H91NO4 and a molecular weight of 758.27 g/mol. Its IUPAC name is [(5Z,8Z,29Z,32Z)-heptatriaconta-5,8,29,32-tetraen-19-yl] 4-(4,4-diethoxybutylamino)butanoate.
| Compound Name | [(5Z,8Z,29Z,32Z)-heptatriaconta-5,8,29,32-tetraen-19-yl] 4-(4,4-diethoxybutylamino)butanoate |
|---|---|
| PubChem CID | 166470332 |
| Molecular Formula | C49H91NO4 |
| Molecular Weight | 758.27 g/mol |
| Exact Mass | 757.69 |
| IUPAC Name | [(5Z,8Z,29Z,32Z)-heptatriaconta-5,8,29,32-tetraen-19-yl] 4-(4,4-diethoxybutylamino)butanoate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC/C=C\C/C=C\CCCC)OC(=O)CCCNCCCC(OCC)OCC |
| InChI | InChI=1S/C49H91NO4/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41-47(54-48(51)43-39-45-50-46-40-44-49(52-7-3)53-8-4)42-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h13-16,19-22,47,49-50H,5-12,17-18,23-46H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | FOOZGVYKZFFAFU-KWXKLSQISA-N |
| XLogP | 14.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.27 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|