C9H18NO2+ — CID 166474322
1-(4-hydroxy-1,1-dimethylpiperidin-1-ium-4-yl)ethanone (PubChem CID 166474322) has the molecular formula C9H18NO2+ and a molecular weight of 172.25 g/mol. Its IUPAC name is 1-(4-hydroxy-1,1-dimethylpiperidin-1-ium-4-yl)ethanone.
| Compound Name | 1-(4-hydroxy-1,1-dimethylpiperidin-1-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 166474322 |
| Molecular Formula | C9H18NO2+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-(4-hydroxy-1,1-dimethylpiperidin-1-ium-4-yl)ethanone |
| SMILES | CC(=O)C1(O)CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C9H18NO2/c1-8(11)9(12)4-6-10(2,3)7-5-9/h12H,4-7H2,1-3H3/q+1 |
| InChIKey | UAOYQXFBSCFEIG-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|