C10H20NO2+ — CID 101394183
9,9-dimethyl-1,5-dioxa-9-azoniaspiro[5.5]undecane (PubChem CID 101394183) has the molecular formula C10H20NO2+ and a molecular weight of 186.27 g/mol. Its IUPAC name is 9,9-dimethyl-1,5-dioxa-9-azoniaspiro[5.5]undecane.
| Compound Name | 9,9-dimethyl-1,5-dioxa-9-azoniaspiro[5.5]undecane |
|---|---|
| PubChem CID | 101394183 |
| Molecular Formula | C10H20NO2+ |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 9,9-dimethyl-1,5-dioxa-9-azoniaspiro[5.5]undecane |
| SMILES | C[N+]1(C)CCC2(CC1)OCCCO2 |
| InChI | InChI=1S/C10H20NO2/c1-11(2)6-4-10(5-7-11)12-8-3-9-13-10/h3-9H2,1-2H3/q+1 |
| InChIKey | FOJQEYKVCWPCKE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|