C7H13NO3 — CID 167029061
1-[(1R,3R)-1-hydroxy-3-(hydroxyamino)cyclopentyl]ethanone (PubChem CID 167029061) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is 1-[(1R,3R)-1-hydroxy-3-(hydroxyamino)cyclopentyl]ethanone.
| Compound Name | 1-[(1R,3R)-1-hydroxy-3-(hydroxyamino)cyclopentyl]ethanone |
|---|---|
| PubChem CID | 167029061 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1-[(1R,3R)-1-hydroxy-3-(hydroxyamino)cyclopentyl]ethanone |
| SMILES | CC(=O)[C@@]1(O)CC[C@@H](NO)C1 |
| InChI | InChI=1S/C7H13NO3/c1-5(9)7(10)3-2-6(4-7)8-11/h6,8,10-11H,2-4H2,1H3/t6-,7-/m1/s1 |
| InChIKey | JYTZOZWKAWNWIC-RNFRBKRXSA-N |
| XLogP | -0.16 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|