C14H10F4N2OS — CID 166475419
N-[amino-(4-fluorophenyl)-λ4-sulfanylidene]-4-(trifluoromethyl)benzamide (PubChem CID 166475419) has the molecular formula C14H10F4N2OS and a molecular weight of 330.31 g/mol. Its IUPAC name is N-[amino-(4-fluorophenyl)-λ4-sulfanylidene]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[amino-(4-fluorophenyl)-λ4-sulfanylidene]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166475419 |
| Molecular Formula | C14H10F4N2OS |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-[amino-(4-fluorophenyl)-λ4-sulfanylidene]-4-(trifluoromethyl)benzamide |
| SMILES | N/S(=N\C(=O)c1ccc(C(F)(F)F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H10F4N2OS/c15-11-5-7-12(8-6-11)22(19)20-13(21)9-1-3-10(4-2-9)14(16,17)18/h1-8H,(H2,19,20,21) |
| InChIKey | YVFAGWPYVBRVKU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |