C10H10ClNORe — CID 166475451
(NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium (PubChem CID 166475451) has the molecular formula C10H10ClNORe and a molecular weight of 381.86 g/mol. Its IUPAC name is (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium.
| Compound Name | (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium |
|---|---|
| PubChem CID | 166475451 |
| Molecular Formula | C10H10ClNORe |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium |
| SMILES | O/N=C1\C(Cl)=CC2C3C=CC(C3)C12.[Re] |
| InChI | InChI=1S/C10H10ClNO.Re/c11-8-4-7-5-1-2-6(3-5)9(7)10(8)12-13;/h1-2,4-7,9,13H,3H2;/b12-10+; |
| InChIKey | NBNIGMOCAQODMC-VHPXAQPISA-N |
| XLogP | 2.39 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|