About (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium
(NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium (PubChem CID 166475451) has the molecular formula C10H10ClNORe
and a molecular weight of 381.86 g/mol. Its IUPAC name is (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium.
Molecular Properties
| Compound Name | (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium |
| PubChem CID | 166475451 |
| Molecular Formula | C10H10ClNORe |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium |
| SMILES | O/N=C1\C(Cl)=CC2C3C=CC(C3)C12.[Re] |
| InChI | InChI=1S/C10H10ClNO.Re/c11-8-4-7-5-1-2-6(3-5)9(7)10(8)12-13;/h1-2,4-7,9,13H,3H2;/b12-10+; |
| InChIKey | NBNIGMOCAQODMC-VHPXAQPISA-N |
| XLogP | 2.39 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium?
The IUPAC name of (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium (CID 166475451) is (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium.
What is the SMILES notation for (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium?
The canonical SMILES for (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium is O/N=C1\C(Cl)=CC2C3C=CC(C3)C12.[Re].
What is the InChIKey of (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium?
The InChIKey is NBNIGMOCAQODMC-VHPXAQPISA-N. The full InChI is InChI=1S/C10H10ClNO.Re/c11-8-4-7-5-1-2-6(3-5)9(7)10(8)12-13;/h1-2,4-7,9,13H,3H2;/b12-10+;.
What are the key properties of (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium?
(NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium has a molecular weight of 381.86 g/mol, XLogP of 2.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(4-chloro-3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine;rhenium is sourced from PubChem (CID 166475451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).