C24H28F3N5O — CID 166476665
N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-4-(oxan-4-ylmethyl)-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-7-amine (PubChem CID 166476665) has the molecular formula C24H28F3N5O and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-4-(oxan-4-ylmethyl)-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-7-amine.
| Compound Name | N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-4-(oxan-4-ylmethyl)-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-7-amine |
|---|---|
| PubChem CID | 166476665 |
| Molecular Formula | C24H28F3N5O |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]-4-(oxan-4-ylmethyl)-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-7-amine |
| SMILES | Cc1c(C(C)Nc2nc3nccn3c3c2CN(CC2CCOCC2)C3)cccc1C(F)(F)F |
| InChI | InChI=1S/C24H28F3N5O/c1-15-18(4-3-5-20(15)24(25,26)27)16(2)29-22-19-13-31(12-17-6-10-33-11-7-17)14-21(19)32-9-8-28-23(32)30-22/h3-5,8-9,16-17H,6-7,10-14H2,1-2H3,(H,28,29,30) |
| InChIKey | DQUYWCUHMSKRJQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |