C18H14BrF3IN3 — CID 164568863
7-bromo-6-iodo-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine (PubChem CID 164568863) has the molecular formula C18H14BrF3IN3 and a molecular weight of 536.13 g/mol. Its IUPAC name is 7-bromo-6-iodo-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine.
| Compound Name | 7-bromo-6-iodo-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 164568863 |
| Molecular Formula | C18H14BrF3IN3 |
| Molecular Weight | 536.13 g/mol |
| Exact Mass | 534.94 |
| IUPAC Name | 7-bromo-6-iodo-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]ethyl]quinazolin-4-amine |
| SMILES | Cc1c([C@@H](C)Nc2ncnc3cc(Br)c(I)cc23)cccc1C(F)(F)F |
| InChI | InChI=1S/C18H14BrF3IN3/c1-9-11(4-3-5-13(9)18(20,21)22)10(2)26-17-12-6-15(23)14(19)7-16(12)24-8-25-17/h3-8,10H,1-2H3,(H,24,25,26)/t10-/m1/s1 |
| InChIKey | NFRRPJKFEJMQJP-SNVBAGLBSA-N |
| XLogP | 6.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.13 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|