C17H31NOS — CID 166478329
(4-ethylphenyl)-hydroxy-methyl-piperidin-1-yl-λ4-sulfane;propane (PubChem CID 166478329) has the molecular formula C17H31NOS and a molecular weight of 297.51 g/mol. Its IUPAC name is (4-ethylphenyl)-hydroxy-methyl-piperidin-1-yl-λ4-sulfane;propane.
| Compound Name | (4-ethylphenyl)-hydroxy-methyl-piperidin-1-yl-λ4-sulfane;propane |
|---|---|
| PubChem CID | 166478329 |
| Molecular Formula | C17H31NOS |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (4-ethylphenyl)-hydroxy-methyl-piperidin-1-yl-λ4-sulfane;propane |
| SMILES | CCC.CCc1ccc(S(C)(O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C14H23NOS.C3H8/c1-3-13-7-9-14(10-8-13)17(2,16)15-11-5-4-6-12-15;1-3-2/h7-10,16H,3-6,11-12H2,1-2H3;3H2,1-2H3 |
| InChIKey | VZDIQCBAGRJGDA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |