C26H32N2O4 — CID 166480800
(2E)-6-[2-(2-hydroxyethoxy)ethoxy]-2-[[1-(2-methylpyrrolidin-1-yl)naphthalen-2-yl]methylidene]-3-oxohexanenitrile (PubChem CID 166480800) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is (2E)-6-[2-(2-hydroxyethoxy)ethoxy]-2-[[1-(2-methylpyrrolidin-1-yl)naphthalen-2-yl]methylidene]-3-oxohexanenitrile.
| Compound Name | (2E)-6-[2-(2-hydroxyethoxy)ethoxy]-2-[[1-(2-methylpyrrolidin-1-yl)naphthalen-2-yl]methylidene]-3-oxohexanenitrile |
|---|---|
| PubChem CID | 166480800 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (2E)-6-[2-(2-hydroxyethoxy)ethoxy]-2-[[1-(2-methylpyrrolidin-1-yl)naphthalen-2-yl]methylidene]-3-oxohexanenitrile |
| SMILES | CC1CCCN1c1c(/C=C(\C#N)C(=O)CCCOCCOCCO)ccc2ccccc12 |
| InChI | InChI=1S/C26H32N2O4/c1-20-6-4-12-28(20)26-22(11-10-21-7-2-3-8-24(21)26)18-23(19-27)25(30)9-5-14-31-16-17-32-15-13-29/h2-3,7-8,10-11,18,20,29H,4-6,9,12-17H2,1H3/b23-18+ |
| InChIKey | AEOOEVBPNMPELG-PTGBLXJZSA-N |
| XLogP | 4.11 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|