C19H26N2O3 — CID 16648243
methyl (Z)-4-(cyclohexylamino)-3-(2,4-dimethylanilino)-4-oxobut-2-enoate (PubChem CID 16648243) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl (Z)-4-(cyclohexylamino)-3-(2,4-dimethylanilino)-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-4-(cyclohexylamino)-3-(2,4-dimethylanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 16648243 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | methyl (Z)-4-(cyclohexylamino)-3-(2,4-dimethylanilino)-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C(\Nc1ccc(C)cc1C)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H26N2O3/c1-13-9-10-16(14(2)11-13)21-17(12-18(22)24-3)19(23)20-15-7-5-4-6-8-15/h9-12,15,21H,4-8H2,1-3H3,(H,20,23)/b17-12- |
| InChIKey | JDWGUHJATWMPJD-ATVHPVEESA-N |
| XLogP | 3.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|