C17H23NO2 — CID 94282724
N-cycloheptyl-2-(2,4-dimethylphenyl)-2-oxoacetamide (PubChem CID 94282724) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-cycloheptyl-2-(2,4-dimethylphenyl)-2-oxoacetamide.
| Compound Name | N-cycloheptyl-2-(2,4-dimethylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 94282724 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N-cycloheptyl-2-(2,4-dimethylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(C(=O)C(=O)NC2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C17H23NO2/c1-12-9-10-15(13(2)11-12)16(19)17(20)18-14-7-5-3-4-6-8-14/h9-11,14H,3-8H2,1-2H3,(H,18,20) |
| InChIKey | DEPBMYLHOBXVRU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|