C18H25NO3 — CID 40699149
[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2,4-dimethylbenzoate (PubChem CID 40699149) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2,4-dimethylbenzoate.
| Compound Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 40699149 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H](C)C(=O)NC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H25NO3/c1-12-9-10-16(13(2)11-12)18(21)22-14(3)17(20)19-15-7-5-4-6-8-15/h9-11,14-15H,4-8H2,1-3H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | SCHMSYJHQNGVLS-CQSZACIVSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |