C20H18ClN3OS — CID 16648309
(2E)-5-benzyl-2-[(E)-(2-chlorophenyl)methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 16648309) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is (2E)-5-benzyl-2-[(E)-(2-chlorophenyl)methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-benzyl-2-[(E)-(2-chlorophenyl)methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16648309 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (2E)-5-benzyl-2-[(E)-(2-chlorophenyl)methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(Cc2ccccc2)S/C1=N/N=C/c1ccccc1Cl |
| InChI | InChI=1S/C20H18ClN3OS/c1-2-12-24-19(25)18(13-15-8-4-3-5-9-15)26-20(24)23-22-14-16-10-6-7-11-17(16)21/h2-11,14,18H,1,12-13H2/b22-14+,23-20+ |
| InChIKey | OXAZPSKTONAKBR-DAEAJKMYSA-N |
| XLogP | 4.40 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|