C18H16ClN3O2S — CID 7472482
(2Z,5R)-5-[(3-chlorophenyl)methyl]-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 7472482) has the molecular formula C18H16ClN3O2S and a molecular weight of 373.87 g/mol. Its IUPAC name is (2Z,5R)-5-[(3-chlorophenyl)methyl]-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-5-[(3-chlorophenyl)methyl]-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7472482 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (2Z,5R)-5-[(3-chlorophenyl)methyl]-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)[C@@H](Cc2cccc(Cl)c2)S/C1=N\N=C/c1ccco1 |
| InChI | InChI=1S/C18H16ClN3O2S/c1-2-8-22-17(23)16(11-13-5-3-6-14(19)10-13)25-18(22)21-20-12-15-7-4-9-24-15/h2-7,9-10,12,16H,1,8,11H2/b20-12-,21-18-/t16-/m1/s1 |
| InChIKey | SFUUXISYGXLKHO-JLXHZPSVSA-N |
| XLogP | 4.00 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|