C22H19N3O3S — CID 3106377
2-(furan-2-ylmethylidenehydrazinylidene)-5-[(4-methoxyphenyl)methyl]-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 3106377) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-(furan-2-ylmethylidenehydrazinylidene)-5-[(4-methoxyphenyl)methyl]-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(furan-2-ylmethylidenehydrazinylidene)-5-[(4-methoxyphenyl)methyl]-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3106377 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-(furan-2-ylmethylidenehydrazinylidene)-5-[(4-methoxyphenyl)methyl]-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CC2SC(=NN=Cc3ccco3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-27-18-11-9-16(10-12-18)14-20-21(26)25(17-6-3-2-4-7-17)22(29-20)24-23-15-19-8-5-13-28-19/h2-13,15,20H,14H2,1H3 |
| InChIKey | DMRLKRJDAJNMDH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|