C16H14FN3O2S — CID 40785238
(2E,5S)-5-ethyl-3-(4-fluorophenyl)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 40785238) has the molecular formula C16H14FN3O2S and a molecular weight of 331.37 g/mol. Its IUPAC name is (2E,5S)-5-ethyl-3-(4-fluorophenyl)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-5-ethyl-3-(4-fluorophenyl)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40785238 |
| Molecular Formula | C16H14FN3O2S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2E,5S)-5-ethyl-3-(4-fluorophenyl)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC[C@@H]1S/C(=N/N=C\c2ccco2)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C16H14FN3O2S/c1-2-14-15(21)20(12-7-5-11(17)6-8-12)16(23-14)19-18-10-13-4-3-9-22-13/h3-10,14H,2H2,1H3/b18-10-,19-16+/t14-/m0/s1 |
| InChIKey | XCNZYAJNAYUKSU-MMSFWJGYSA-N |
| XLogP | 3.67 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|