C22H22Cl2N4OS — CID 16648312
(2E)-5-[(3,4-dichlorophenyl)methyl]-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 16648312) has the molecular formula C22H22Cl2N4OS and a molecular weight of 461.42 g/mol. Its IUPAC name is (2E)-5-[(3,4-dichlorophenyl)methyl]-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[(3,4-dichlorophenyl)methyl]-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16648312 |
| Molecular Formula | C22H22Cl2N4OS |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | (2E)-5-[(3,4-dichlorophenyl)methyl]-2-[(E)-[4-(dimethylamino)phenyl]methylidenehydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)C(Cc2ccc(Cl)c(Cl)c2)S/C1=N/N=C/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H22Cl2N4OS/c1-4-11-28-21(29)20(13-16-7-10-18(23)19(24)12-16)30-22(28)26-25-14-15-5-8-17(9-6-15)27(2)3/h4-10,12,14,20H,1,11,13H2,2-3H3/b25-14+,26-22+ |
| InChIKey | FHOYKDGPTFBACT-OQIFMASLSA-N |
| XLogP | 5.12 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|