C33H27N3O6S — CID 166485197
methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(4-nitrophenyl)sulfanyl-1H-indol-3-yl]propanoate (PubChem CID 166485197) has the molecular formula C33H27N3O6S and a molecular weight of 593.66 g/mol. Its IUPAC name is methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(4-nitrophenyl)sulfanyl-1H-indol-3-yl]propanoate.
| Compound Name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(4-nitrophenyl)sulfanyl-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 166485197 |
| Molecular Formula | C33H27N3O6S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(4-nitrophenyl)sulfanyl-1H-indol-3-yl]propanoate |
| SMILES | COC(=O)[C@H](Cc1c(Sc2ccc([N+](=O)[O-])cc2)[nH]c2ccccc12)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H27N3O6S/c1-41-32(37)30(35-33(38)42-19-28-24-10-4-2-8-22(24)23-9-3-5-11-25(23)28)18-27-26-12-6-7-13-29(26)34-31(27)43-21-16-14-20(15-17-21)36(39)40/h2-17,28,30,34H,18-19H2,1H3,(H,35,38)/t30-/m0/s1 |
| InChIKey | PMOAMKSJQMIYQN-PMERELPUSA-N |
| XLogP | 6.85 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|