C14H21F2NO3 — CID 166486409
tert-butyl N-(2,2-difluorospiro[3.3]heptan-6-yl)-N-(2-oxoethyl)carbamate (PubChem CID 166486409) has the molecular formula C14H21F2NO3 and a molecular weight of 289.32 g/mol. Its IUPAC name is tert-butyl N-(2,2-difluorospiro[3.3]heptan-6-yl)-N-(2-oxoethyl)carbamate.
| Compound Name | tert-butyl N-(2,2-difluorospiro[3.3]heptan-6-yl)-N-(2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 166486409 |
| Molecular Formula | C14H21F2NO3 |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | tert-butyl N-(2,2-difluorospiro[3.3]heptan-6-yl)-N-(2-oxoethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC=O)C1CC2(C1)CC(F)(F)C2 |
| InChI | InChI=1S/C14H21F2NO3/c1-12(2,3)20-11(19)17(4-5-18)10-6-13(7-10)8-14(15,16)9-13/h5,10H,4,6-9H2,1-3H3 |
| InChIKey | DKTCMYAHFYSJQC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|