C26H24N4O4S — CID 166492762
2-[[(1S)-8-[(3S)-1-(1,3-thiazole-5-carbonyl)pyrrolidin-3-yl]oxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 166492762) has the molecular formula C26H24N4O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-[[(1S)-8-[(3S)-1-(1,3-thiazole-5-carbonyl)pyrrolidin-3-yl]oxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(1S)-8-[(3S)-1-(1,3-thiazole-5-carbonyl)pyrrolidin-3-yl]oxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166492762 |
| Molecular Formula | C26H24N4O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 2-[[(1S)-8-[(3S)-1-(1,3-thiazole-5-carbonyl)pyrrolidin-3-yl]oxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C(c1cncs1)N1CC[C@H](Oc2cccc3c2[C@@H](CN2C(=O)c4ccccc4C2=O)NCC3)C1 |
| InChI | InChI=1S/C26H24N4O4S/c31-24-18-5-1-2-6-19(18)25(32)30(24)14-20-23-16(8-10-28-20)4-3-7-21(23)34-17-9-11-29(13-17)26(33)22-12-27-15-35-22/h1-7,12,15,17,20,28H,8-11,13-14H2/t17-,20+/m0/s1 |
| InChIKey | YYCDOQQIKOBOGF-FXAWDEMLSA-N |
| XLogP | 2.92 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|