C23H26ClN3O4 — CID 166793237
4-[[1-[(1,3-dioxoisoindol-2-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]-N-methylbutanamide;hydrochloride (PubChem CID 166793237) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is 4-[[1-[(1,3-dioxoisoindol-2-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]-N-methylbutanamide;hydrochloride.
| Compound Name | 4-[[1-[(1,3-dioxoisoindol-2-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 166793237 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 4-[[1-[(1,3-dioxoisoindol-2-yl)methyl]-1,2,3,4-tetrahydroisoquinolin-8-yl]oxy]-N-methylbutanamide;hydrochloride |
| SMILES | CNC(=O)CCCOc1cccc2c1C(CN1C(=O)c3ccccc3C1=O)NCC2.Cl |
| InChI | InChI=1S/C23H25N3O4.ClH/c1-24-20(27)10-5-13-30-19-9-4-6-15-11-12-25-18(21(15)19)14-26-22(28)16-7-2-3-8-17(16)23(26)29;/h2-4,6-9,18,25H,5,10-14H2,1H3,(H,24,27);1H |
| InChIKey | KGANOIKKRPPLNM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|