C15H22N2 — CID 166496656
2-[(E)-3,3-dimethylbut-1-enyl]-5-pyrrolidin-1-ylpyridine (PubChem CID 166496656) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-[(E)-3,3-dimethylbut-1-enyl]-5-pyrrolidin-1-ylpyridine.
| Compound Name | 2-[(E)-3,3-dimethylbut-1-enyl]-5-pyrrolidin-1-ylpyridine |
|---|---|
| PubChem CID | 166496656 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-[(E)-3,3-dimethylbut-1-enyl]-5-pyrrolidin-1-ylpyridine |
| SMILES | CC(C)(C)/C=C/c1ccc(N2CCCC2)cn1 |
| InChI | InChI=1S/C15H22N2/c1-15(2,3)9-8-13-6-7-14(12-16-13)17-10-4-5-11-17/h6-9,12H,4-5,10-11H2,1-3H3/b9-8+ |
| InChIKey | UZFHVJOJSHWCFL-CMDGGOBGSA-N |
| XLogP | 3.74 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |